C7H12N2S — CID 142082907
(2E,4Z)-N',2-dimethyl-5-sulfanylpenta-2,4-dienimidamide (PubChem CID 142082907) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is (2E,4Z)-N',2-dimethyl-5-sulfanylpenta-2,4-dienimidamide.
| Compound Name | (2E,4Z)-N',2-dimethyl-5-sulfanylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 142082907 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | (2E,4Z)-N',2-dimethyl-5-sulfanylpenta-2,4-dienimidamide |
| SMILES | C/N=C(N)/C(C)=C/C=C\S |
| InChI | InChI=1S/C7H12N2S/c1-6(4-3-5-10)7(8)9-2/h3-5,10H,1-2H3,(H2,8,9)/b5-3-,6-4+ |
| InChIKey | YGMHNMNXLBSZDB-CIIODKQPSA-N |
| XLogP | 1.36 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|