C9H15N3S — CID 144754266
(3Z,5Z)-N'-[(Z)-2-aminoprop-1-enyl]-6-sulfanylhexa-3,5-dienimidamide (PubChem CID 144754266) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is (3Z,5Z)-N'-[(Z)-2-aminoprop-1-enyl]-6-sulfanylhexa-3,5-dienimidamide.
| Compound Name | (3Z,5Z)-N'-[(Z)-2-aminoprop-1-enyl]-6-sulfanylhexa-3,5-dienimidamide |
|---|---|
| PubChem CID | 144754266 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (3Z,5Z)-N'-[(Z)-2-aminoprop-1-enyl]-6-sulfanylhexa-3,5-dienimidamide |
| SMILES | C/C(N)=C/N=C(\N)C/C=C\C=C/S |
| InChI | InChI=1S/C9H15N3S/c1-8(10)7-12-9(11)5-3-2-4-6-13/h2-4,6-7,13H,5,10H2,1H3,(H2,11,12)/b3-2-,6-4-,8-7- |
| InChIKey | BSXSMMRYEXBOQH-MLOOLDTESA-N |
| XLogP | 1.55 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|