C40H57N — CID 141175966
4,5,6,7,8,9,10,11,12,13,14-undeca(ethylidene)-15-methylheptadeca-2,15-dien-3-amine (PubChem CID 141175966) has the molecular formula C40H57N and a molecular weight of 551.90 g/mol. Its IUPAC name is 4,5,6,7,8,9,10,11,12,13,14-undeca(ethylidene)-15-methylheptadeca-2,15-dien-3-amine.
| Compound Name | 4,5,6,7,8,9,10,11,12,13,14-undeca(ethylidene)-15-methylheptadeca-2,15-dien-3-amine |
|---|---|
| PubChem CID | 141175966 |
| Molecular Formula | C40H57N |
| Molecular Weight | 551.90 g/mol |
| Exact Mass | 551.45 |
| IUPAC Name | 4,5,6,7,8,9,10,11,12,13,14-undeca(ethylidene)-15-methylheptadeca-2,15-dien-3-amine |
| SMILES | CC=C(C)C(=CC)C(=CC)C(=CC)C(=CC)C(=CC)C(=CC)C(=CC)C(=CC)C(=CC)C(=CC)C(=CC)C(N)=CC |
| InChI | InChI=1S/C40H57N/c1-15-28(14)29(16-2)30(17-3)31(18-4)32(19-5)33(20-6)34(21-7)35(22-8)36(23-9)37(24-10)38(25-11)39(26-12)40(41)27-13/h15-27H,41H2,1-14H3 |
| InChIKey | MKDJZYYTEBLDEJ-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.90 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|