C18H44 — CID 144531005
methane;(2E,4Z,6E)-3,4,5,6-tetramethylocta-2,4,6-triene (PubChem CID 144531005) has the molecular formula C18H44 and a molecular weight of 260.55 g/mol. Its IUPAC name is methane;(2E,4Z,6E)-3,4,5,6-tetramethylocta-2,4,6-triene.
| Compound Name | methane;(2E,4Z,6E)-3,4,5,6-tetramethylocta-2,4,6-triene |
|---|---|
| PubChem CID | 144531005 |
| Molecular Formula | C18H44 |
| Molecular Weight | 260.55 g/mol |
| Exact Mass | 260.34 |
| IUPAC Name | methane;(2E,4Z,6E)-3,4,5,6-tetramethylocta-2,4,6-triene |
| SMILES | C.C.C.C.C.C.C/C=C(C)/C(C)=C(C)\C(C)=C\C |
| InChI | InChI=1S/C12H20.6CH4/c1-7-9(3)11(5)12(6)10(4)8-2;;;;;;/h7-8H,1-6H3;6*1H4/b9-7+,10-8+,12-11-;;;;;; |
| InChIKey | QIZJZZBCGCWLRF-QJHLYLNFSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.55 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|