About ethenyl 2-methylbuta-2,3-dienoate
ethenyl 2-methylbuta-2,3-dienoate (PubChem CID 174869086) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is ethenyl 2-methylbuta-2,3-dienoate.
Molecular Properties
| Compound Name | ethenyl 2-methylbuta-2,3-dienoate |
| PubChem CID | 174869086 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | ethenyl 2-methylbuta-2,3-dienoate |
| SMILES | C=C=C(C)C(=O)OC=C |
| InChI | InChI=1S/C7H8O2/c1-4-6(3)7(8)9-5-2/h5H,1-2H2,3H3 |
| InChIKey | MMNDBGZZELMSJA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 2-methylbuta-2,3-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 2-methylbuta-2,3-dienoate?
The IUPAC name of ethenyl 2-methylbuta-2,3-dienoate (CID 174869086) is ethenyl 2-methylbuta-2,3-dienoate.
What is the SMILES notation for ethenyl 2-methylbuta-2,3-dienoate?
The canonical SMILES for ethenyl 2-methylbuta-2,3-dienoate is C=C=C(C)C(=O)OC=C.
What is the InChIKey of ethenyl 2-methylbuta-2,3-dienoate?
The InChIKey is MMNDBGZZELMSJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2/c1-4-6(3)7(8)9-5-2/h5H,1-2H2,3H3.
What are the key properties of ethenyl 2-methylbuta-2,3-dienoate?
ethenyl 2-methylbuta-2,3-dienoate has a molecular weight of 124.14 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 2-methylbuta-2,3-dienoate is sourced from PubChem (CID 174869086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).