About ethenyl 2-acetyloxybut-2-enoate
ethenyl 2-acetyloxybut-2-enoate (PubChem CID 174371549) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is ethenyl 2-acetyloxybut-2-enoate.
Molecular Properties
| Compound Name | ethenyl 2-acetyloxybut-2-enoate |
| PubChem CID | 174371549 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | ethenyl 2-acetyloxybut-2-enoate |
| SMILES | C=COC(=O)C(=CC)OC(C)=O |
| InChI | InChI=1S/C8H10O4/c1-4-7(12-6(3)9)8(10)11-5-2/h4-5H,2H2,1,3H3 |
| InChIKey | MHBQLIYRZJLMHV-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 2-acetyloxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 2-acetyloxybut-2-enoate?
The IUPAC name of ethenyl 2-acetyloxybut-2-enoate (CID 174371549) is ethenyl 2-acetyloxybut-2-enoate.
What is the SMILES notation for ethenyl 2-acetyloxybut-2-enoate?
The canonical SMILES for ethenyl 2-acetyloxybut-2-enoate is C=COC(=O)C(=CC)OC(C)=O.
What is the InChIKey of ethenyl 2-acetyloxybut-2-enoate?
The InChIKey is MHBQLIYRZJLMHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c1-4-7(12-6(3)9)8(10)11-5-2/h4-5H,2H2,1,3H3.
What are the key properties of ethenyl 2-acetyloxybut-2-enoate?
ethenyl 2-acetyloxybut-2-enoate has a molecular weight of 170.16 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 2-acetyloxybut-2-enoate is sourced from PubChem (CID 174371549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).