C11H19N3O — CID 171794842
N-[(3E)-2-carbamimidoylocta-1,3-dien-4-yl]acetamide (PubChem CID 171794842) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-[(3E)-2-carbamimidoylocta-1,3-dien-4-yl]acetamide.
| Compound Name | N-[(3E)-2-carbamimidoylocta-1,3-dien-4-yl]acetamide |
|---|---|
| PubChem CID | 171794842 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-[(3E)-2-carbamimidoylocta-1,3-dien-4-yl]acetamide |
| SMILES | [H]/N=C(\N)C(=C)/C=C(\CCCC)NC(C)=O |
| InChI | InChI=1S/C11H19N3O/c1-4-5-6-10(14-9(3)15)7-8(2)11(12)13/h7H,2,4-6H2,1,3H3,(H3,12,13)(H,14,15)/b10-7+ |
| InChIKey | RPBNBMIXEXIUOL-JXMROGBWSA-N |
| XLogP | 1.69 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|