C7H12N2O — CID 139357083
N-[(2Z)-4-aminopenta-2,4-dien-2-yl]acetamide (PubChem CID 139357083) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is N-[(2Z)-4-aminopenta-2,4-dien-2-yl]acetamide.
| Compound Name | N-[(2Z)-4-aminopenta-2,4-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 139357083 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | N-[(2Z)-4-aminopenta-2,4-dien-2-yl]acetamide |
| SMILES | C=C(N)/C=C(/C)NC(C)=O |
| InChI | InChI=1S/C7H12N2O/c1-5(8)4-6(2)9-7(3)10/h4H,1,8H2,2-3H3,(H,9,10)/b6-4- |
| InChIKey | SIWKFJNTVYWGAY-XQRVVYSFSA-N |
| XLogP | 0.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|