About N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide
N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide (PubChem CID 123534155) has the molecular formula C11H19NOS
and a molecular weight of 213.35 g/mol. Its IUPAC name is N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide |
| PubChem CID | 123534155 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide |
| SMILES | C=C(C=CS(C)(C)C)C(=C)NC(C)=O |
| InChI | InChI=1S/C11H19NOS/c1-9(7-8-14(4,5)6)10(2)12-11(3)13/h7-8H,1-2H2,3-6H3,(H,12,13) |
| InChIKey | QDZBWHOSGYPZKE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide?
The IUPAC name of N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide (CID 123534155) is N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide.
What is the SMILES notation for N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide?
The canonical SMILES for N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide is C=C(C=CS(C)(C)C)C(=C)NC(C)=O.
What is the InChIKey of N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide?
The InChIKey is QDZBWHOSGYPZKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NOS/c1-9(7-8-14(4,5)6)10(2)12-11(3)13/h7-8H,1-2H2,3-6H3,(H,12,13).
What are the key properties of N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide?
N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide has a molecular weight of 213.35 g/mol, XLogP of 2.40, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide is sourced from PubChem (CID 123534155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).