C11H19NOS — CID 123534155
N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide (PubChem CID 123534155) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide.
| Compound Name | N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 123534155 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | N-[3-methylidene-5-(trimethyl-λ4-sulfanyl)penta-1,4-dien-2-yl]acetamide |
| SMILES | C=C(C=CS(C)(C)C)C(=C)NC(C)=O |
| InChI | InChI=1S/C11H19NOS/c1-9(7-8-14(4,5)6)10(2)12-11(3)13/h7-8H,1-2H2,3-6H3,(H,12,13) |
| InChIKey | QDZBWHOSGYPZKE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|