C11H18N2O2 — CID 134458144
(2E)-4-acetamido-2-methyl-N-propan-2-ylpenta-2,4-dienamide (PubChem CID 134458144) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (2E)-4-acetamido-2-methyl-N-propan-2-ylpenta-2,4-dienamide.
| Compound Name | (2E)-4-acetamido-2-methyl-N-propan-2-ylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 134458144 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (2E)-4-acetamido-2-methyl-N-propan-2-ylpenta-2,4-dienamide |
| SMILES | C=C(/C=C(\C)C(=O)NC(C)C)NC(C)=O |
| InChI | InChI=1S/C11H18N2O2/c1-7(2)12-11(15)8(3)6-9(4)13-10(5)14/h6-7H,4H2,1-3,5H3,(H,12,15)(H,13,14)/b8-6+ |
| InChIKey | YASXKUKROUEZGD-SOFGYWHQSA-N |
| XLogP | 1.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|