C11H18N2O3 — CID 143887807
ethane;N-[(3Z,5Z)-3-nitrohepta-1,3,5-trien-4-yl]acetamide (PubChem CID 143887807) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is ethane;N-[(3Z,5Z)-3-nitrohepta-1,3,5-trien-4-yl]acetamide.
| Compound Name | ethane;N-[(3Z,5Z)-3-nitrohepta-1,3,5-trien-4-yl]acetamide |
|---|---|
| PubChem CID | 143887807 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | ethane;N-[(3Z,5Z)-3-nitrohepta-1,3,5-trien-4-yl]acetamide |
| SMILES | C=C/C(=C(\C=C/C)NC(C)=O)[N+](=O)[O-].CC |
| InChI | InChI=1S/C9H12N2O3.C2H6/c1-4-6-8(10-7(3)12)9(5-2)11(13)14;1-2/h4-6H,2H2,1,3H3,(H,10,12);1-2H3/b6-4-,9-8-; |
| InChIKey | XFAZOODMDBOYQB-WYURWAOTSA-N |
| XLogP | 2.40 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|