About ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate
ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate (PubChem CID 145019580) has the molecular formula C12H15NO5
and a molecular weight of 253.25 g/mol. Its IUPAC name is ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate.
Molecular Properties
| Compound Name | ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate |
| PubChem CID | 145019580 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate |
| SMILES | C=C/C(=C(\C=C/C)C(C=O)C(=O)OCC)[N+](=O)[O-] |
| InChI | InChI=1S/C12H15NO5/c1-4-7-9(11(5-2)13(16)17)10(8-14)12(15)18-6-3/h4-5,7-8,10H,2,6H2,1,3H3/b7-4-,11-9- |
| InChIKey | QDXLYMDYFQPFBW-SKQDYVHHSA-N |
| XLogP | 1.66 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate?
The IUPAC name of ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate (CID 145019580) is ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate.
What is the SMILES notation for ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate?
The canonical SMILES for ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate is C=C/C(=C(\C=C/C)C(C=O)C(=O)OCC)[N+](=O)[O-].
What is the InChIKey of ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate?
The InChIKey is QDXLYMDYFQPFBW-SKQDYVHHSA-N. The full InChI is InChI=1S/C12H15NO5/c1-4-7-9(11(5-2)13(16)17)10(8-14)12(15)18-6-3/h4-5,7-8,10H,2,6H2,1,3H3/b7-4-,11-9-.
What are the key properties of ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate?
ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate has a molecular weight of 253.25 g/mol, XLogP of 1.66, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3Z)-2-formyl-4-nitro-3-[(Z)-prop-1-enyl]hexa-3,5-dienoate is sourced from PubChem (CID 145019580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).