C10H18N2O2 — CID 171549648
ethane;(2E,4Z)-N-methyl-3-nitrohepta-2,4,6-trien-2-amine (PubChem CID 171549648) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is ethane;(2E,4Z)-N-methyl-3-nitrohepta-2,4,6-trien-2-amine.
| Compound Name | ethane;(2E,4Z)-N-methyl-3-nitrohepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 171549648 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | ethane;(2E,4Z)-N-methyl-3-nitrohepta-2,4,6-trien-2-amine |
| SMILES | C=C/C=C\C(=C(\C)NC)[N+](=O)[O-].CC |
| InChI | InChI=1S/C8H12N2O2.C2H6/c1-4-5-6-8(10(11)12)7(2)9-3;1-2/h4-6,9H,1H2,2-3H3;1-2H3/b6-5-,8-7+; |
| InChIKey | ONIUHALJZULCRX-DUZKJZLISA-N |
| XLogP | 2.48 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|