C10H15NO2 — CID 144546397
(2Z,3Z)-2-(1-methoxyethylidene)-N-methylhexa-3,5-dienamide (PubChem CID 144546397) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (2Z,3Z)-2-(1-methoxyethylidene)-N-methylhexa-3,5-dienamide.
| Compound Name | (2Z,3Z)-2-(1-methoxyethylidene)-N-methylhexa-3,5-dienamide |
|---|---|
| PubChem CID | 144546397 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (2Z,3Z)-2-(1-methoxyethylidene)-N-methylhexa-3,5-dienamide |
| SMILES | C=C/C=C\C(C(=O)NC)=C(/C)OC |
| InChI | InChI=1S/C10H15NO2/c1-5-6-7-9(8(2)13-4)10(12)11-3/h5-7H,1H2,2-4H3,(H,11,12)/b7-6-,9-8- |
| InChIKey | FLQICXQGHZVPTK-JPDBVBESSA-N |
| XLogP | 1.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|