C14H24N2O2 — CID 143696304
(2Z,4Z)-2-ethenyl-N-(2-methylpropyl)-3-nitrohepta-2,4,6-trien-1-amine;methane (PubChem CID 143696304) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (2Z,4Z)-2-ethenyl-N-(2-methylpropyl)-3-nitrohepta-2,4,6-trien-1-amine;methane.
| Compound Name | (2Z,4Z)-2-ethenyl-N-(2-methylpropyl)-3-nitrohepta-2,4,6-trien-1-amine;methane |
|---|---|
| PubChem CID | 143696304 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (2Z,4Z)-2-ethenyl-N-(2-methylpropyl)-3-nitrohepta-2,4,6-trien-1-amine;methane |
| SMILES | C.C=C/C=C\C(=C(/C=C)CNCC(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C13H20N2O2.CH4/c1-5-7-8-13(15(16)17)12(6-2)10-14-9-11(3)4;/h5-8,11,14H,1-2,9-10H2,3-4H3;1H4/b8-7-,13-12-; |
| InChIKey | ODGQIABZILRVMY-BDZWZTQTSA-N |
| XLogP | 3.33 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|