C13H21NO2 — CID 170451642
(4E,6Z)-1-(2-methylpropylamino)nona-4,6-diene-2,3-dione (PubChem CID 170451642) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is (4E,6Z)-1-(2-methylpropylamino)nona-4,6-diene-2,3-dione.
| Compound Name | (4E,6Z)-1-(2-methylpropylamino)nona-4,6-diene-2,3-dione |
|---|---|
| PubChem CID | 170451642 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (4E,6Z)-1-(2-methylpropylamino)nona-4,6-diene-2,3-dione |
| SMILES | CC/C=C\C=C\C(=O)C(=O)CNCC(C)C |
| InChI | InChI=1S/C13H21NO2/c1-4-5-6-7-8-12(15)13(16)10-14-9-11(2)3/h5-8,11,14H,4,9-10H2,1-3H3/b6-5-,8-7+ |
| InChIKey | VXAAQSLCXKQCBX-IGTJQSIKSA-N |
| XLogP | 1.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|