C9H14N2O — CID 89013106
N-[(1E,3Z)-1-amino-5-methylhexa-1,3,5-trien-2-yl]acetamide (PubChem CID 89013106) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is N-[(1E,3Z)-1-amino-5-methylhexa-1,3,5-trien-2-yl]acetamide.
| Compound Name | N-[(1E,3Z)-1-amino-5-methylhexa-1,3,5-trien-2-yl]acetamide |
|---|---|
| PubChem CID | 89013106 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | N-[(1E,3Z)-1-amino-5-methylhexa-1,3,5-trien-2-yl]acetamide |
| SMILES | C=C(C)/C=C\C(=C/N)NC(C)=O |
| InChI | InChI=1S/C9H14N2O/c1-7(2)4-5-9(6-10)11-8(3)12/h4-6H,1,10H2,2-3H3,(H,11,12)/b5-4-,9-6+ |
| InChIKey | OLCHZIPYXQQIOY-KMOPYBJPSA-N |
| XLogP | 1.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|