C5H8N2O — CID 170703461
(3Z)-4-amino-4-(methylideneamino)buta-1,3-dien-2-ol (PubChem CID 170703461) has the molecular formula C5H8N2O and a molecular weight of 112.13 g/mol. Its IUPAC name is (3Z)-4-amino-4-(methylideneamino)buta-1,3-dien-2-ol.
| Compound Name | (3Z)-4-amino-4-(methylideneamino)buta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 170703461 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | (3Z)-4-amino-4-(methylideneamino)buta-1,3-dien-2-ol |
| SMILES | C=N/C(N)=C\C(=C)O |
| InChI | InChI=1S/C5H8N2O/c1-4(8)3-5(6)7-2/h3,8H,1-2,6H2/b5-3- |
| InChIKey | QVQWNKLXBRWDND-HYXAFXHYSA-N |
| XLogP | 0.56 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|