C6H7ClO2 — CID 142903304
(3E)-5-chlorohexa-1,3,5-triene-2,4-diol (PubChem CID 142903304) has the molecular formula C6H7ClO2 and a molecular weight of 146.57 g/mol. Its IUPAC name is (3E)-5-chlorohexa-1,3,5-triene-2,4-diol.
| Compound Name | (3E)-5-chlorohexa-1,3,5-triene-2,4-diol |
|---|---|
| PubChem CID | 142903304 |
| Molecular Formula | C6H7ClO2 |
| Molecular Weight | 146.57 g/mol |
| Exact Mass | 146.01 |
| IUPAC Name | (3E)-5-chlorohexa-1,3,5-triene-2,4-diol |
| SMILES | C=C(O)/C=C(/O)C(=C)Cl |
| InChI | InChI=1S/C6H7ClO2/c1-4(8)3-6(9)5(2)7/h3,8-9H,1-2H2/b6-3+ |
| InChIKey | BDAVQRWYINGSIP-ZZXKWVIFSA-N |
| XLogP | 2.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|