About (1Z)-1,2,3-trichlorobuta-1,3-diene
(1Z)-1,2,3-trichlorobuta-1,3-diene (PubChem CID 6433283) has the molecular formula C4H3Cl3
and a molecular weight of 157.43 g/mol. Its IUPAC name is (1Z)-1,2,3-trichlorobuta-1,3-diene.
Molecular Properties
| Compound Name | (1Z)-1,2,3-trichlorobuta-1,3-diene |
| PubChem CID | 6433283 |
| Molecular Formula | C4H3Cl3 |
| Molecular Weight | 157.43 g/mol |
| Exact Mass | 155.93 |
| IUPAC Name | (1Z)-1,2,3-trichlorobuta-1,3-diene |
| SMILES | C=C(Cl)/C(Cl)=C/Cl |
| InChI | InChI=1S/C4H3Cl3/c1-3(6)4(7)2-5/h2H,1H2/b4-2- |
| InChIKey | MESXUXRSZSSKIO-RQOWECAXSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1,2,3-trichlorobuta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1,2,3-trichlorobuta-1,3-diene?
The IUPAC name of (1Z)-1,2,3-trichlorobuta-1,3-diene (CID 6433283) is (1Z)-1,2,3-trichlorobuta-1,3-diene.
What is the SMILES notation for (1Z)-1,2,3-trichlorobuta-1,3-diene?
The canonical SMILES for (1Z)-1,2,3-trichlorobuta-1,3-diene is C=C(Cl)/C(Cl)=C/Cl.
What is the InChIKey of (1Z)-1,2,3-trichlorobuta-1,3-diene?
The InChIKey is MESXUXRSZSSKIO-RQOWECAXSA-N. The full InChI is InChI=1S/C4H3Cl3/c1-3(6)4(7)2-5/h2H,1H2/b4-2-.
What are the key properties of (1Z)-1,2,3-trichlorobuta-1,3-diene?
(1Z)-1,2,3-trichlorobuta-1,3-diene has a molecular weight of 157.43 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1,2,3-trichlorobuta-1,3-diene is sourced from PubChem (CID 6433283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).