C4H3Cl3 — CID 6433283
(1Z)-1,2,3-trichlorobuta-1,3-diene (PubChem CID 6433283) has the molecular formula C4H3Cl3 and a molecular weight of 157.43 g/mol. Its IUPAC name is (1Z)-1,2,3-trichlorobuta-1,3-diene.
| Compound Name | (1Z)-1,2,3-trichlorobuta-1,3-diene |
|---|---|
| PubChem CID | 6433283 |
| Molecular Formula | C4H3Cl3 |
| Molecular Weight | 157.43 g/mol |
| Exact Mass | 155.93 |
| IUPAC Name | (1Z)-1,2,3-trichlorobuta-1,3-diene |
| SMILES | C=C(Cl)/C(Cl)=C/Cl |
| InChI | InChI=1S/C4H3Cl3/c1-3(6)4(7)2-5/h2H,1H2/b4-2- |
| InChIKey | MESXUXRSZSSKIO-RQOWECAXSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|