C8H7Cl5 — CID 88620289
2,3,5,6,7-pentachloro-5-methylhepta-1,3,6-triene (PubChem CID 88620289) has the molecular formula C8H7Cl5 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2,3,5,6,7-pentachloro-5-methylhepta-1,3,6-triene.
| Compound Name | 2,3,5,6,7-pentachloro-5-methylhepta-1,3,6-triene |
|---|---|
| PubChem CID | 88620289 |
| Molecular Formula | C8H7Cl5 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 277.90 |
| IUPAC Name | 2,3,5,6,7-pentachloro-5-methylhepta-1,3,6-triene |
| SMILES | C=C(Cl)C(Cl)=CC(C)(Cl)C(Cl)=CCl |
| InChI | InChI=1S/C8H7Cl5/c1-5(10)6(11)3-8(2,13)7(12)4-9/h3-4H,1H2,2H3 |
| InChIKey | HSCSDKVQZWOMFV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|