C5H5Cl3 — CID 71430136
1,2,4-trichloro-3-methylbuta-1,3-diene (PubChem CID 71430136) has the molecular formula C5H5Cl3 and a molecular weight of 171.45 g/mol. Its IUPAC name is 1,2,4-trichloro-3-methylbuta-1,3-diene.
| Compound Name | 1,2,4-trichloro-3-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 71430136 |
| Molecular Formula | C5H5Cl3 |
| Molecular Weight | 171.45 g/mol |
| Exact Mass | 169.95 |
| IUPAC Name | 1,2,4-trichloro-3-methylbuta-1,3-diene |
| SMILES | CC(=CCl)C(Cl)=CCl |
| InChI | InChI=1S/C5H5Cl3/c1-4(2-6)5(8)3-7/h2-3H,1H3 |
| InChIKey | MLSCQDCSQLOFAR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|