C5H5Cl3 — CID 13213505
(1E)-1,2-dichloro-3-(chloromethyl)buta-1,3-diene (PubChem CID 13213505) has the molecular formula C5H5Cl3 and a molecular weight of 171.45 g/mol. Its IUPAC name is (1E)-1,2-dichloro-3-(chloromethyl)buta-1,3-diene.
| Compound Name | (1E)-1,2-dichloro-3-(chloromethyl)buta-1,3-diene |
|---|---|
| PubChem CID | 13213505 |
| Molecular Formula | C5H5Cl3 |
| Molecular Weight | 171.45 g/mol |
| Exact Mass | 169.95 |
| IUPAC Name | (1E)-1,2-dichloro-3-(chloromethyl)buta-1,3-diene |
| SMILES | C=C(CCl)/C(Cl)=C\Cl |
| InChI | InChI=1S/C5H5Cl3/c1-4(2-6)5(8)3-7/h3H,1-2H2/b5-3+ |
| InChIKey | KLWMUOHIFYRTBF-HWKANZROSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|