C12H16ClN3O — CID 169189927
(2Z,4E,6E)-4-amino-5-hydroxy-2,3-dimethyl-6-[(methylideneamino)methylidene]octa-2,4,7-trienimidoyl chloride (PubChem CID 169189927) has the molecular formula C12H16ClN3O and a molecular weight of 253.73 g/mol. Its IUPAC name is (2Z,4E,6E)-4-amino-5-hydroxy-2,3-dimethyl-6-[(methylideneamino)methylidene]octa-2,4,7-trienimidoyl chloride.
| Compound Name | (2Z,4E,6E)-4-amino-5-hydroxy-2,3-dimethyl-6-[(methylideneamino)methylidene]octa-2,4,7-trienimidoyl chloride |
|---|---|
| PubChem CID | 169189927 |
| Molecular Formula | C12H16ClN3O |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (2Z,4E,6E)-4-amino-5-hydroxy-2,3-dimethyl-6-[(methylideneamino)methylidene]octa-2,4,7-trienimidoyl chloride |
| SMILES | [H]/N=C(Cl)/C(C)=C(C)\C(N)=C(O)/C(C=C)=C/N=C |
| InChI | InChI=1S/C12H16ClN3O/c1-5-9(6-16-4)11(17)10(14)7(2)8(3)12(13)15/h5-6,15,17H,1,4,14H2,2-3H3/b8-7-,9-6+,11-10+,15-12- |
| InChIKey | VJYWPOLFKNVSGW-OUHHUVQKSA-N |
| XLogP | 3.04 |
| TPSA | 82.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|