C24H33N — CID 142085794
(2Z,3E)-2-ethylidene-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-imine;1-methyl-4-[(Z)-pent-2-en-2-yl]benzene (PubChem CID 142085794) has the molecular formula C24H33N and a molecular weight of 335.54 g/mol. Its IUPAC name is (2Z,3E)-2-ethylidene-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-imine;1-methyl-4-[(Z)-pent-2-en-2-yl]benzene.
| Compound Name | (2Z,3E)-2-ethylidene-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-imine;1-methyl-4-[(Z)-pent-2-en-2-yl]benzene |
|---|---|
| PubChem CID | 142085794 |
| Molecular Formula | C24H33N |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | (2Z,3E)-2-ethylidene-N-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-imine;1-methyl-4-[(Z)-pent-2-en-2-yl]benzene |
| SMILES | C=C/C=C(\C=C/C)C(=C/C)/C=N/C.CC/C=C(/C)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H17N.C12H16/c1-5-8-12(9-6-2)11(7-3)10-13-4;1-4-5-11(3)12-8-6-10(2)7-9-12/h5-10H,1H2,2-4H3;5-9H,4H2,1-3H3/b9-6-,11-7+,12-8+,13-10+;11-5- |
| InChIKey | DJPIGNSUNAJSIM-BOLCUVIDSA-N |
| XLogP | 7.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|