C13H15F3 — CID 138652147
1-[(E)-pent-2-en-2-yl]-4-(2,2,2-trifluoroethyl)benzene (PubChem CID 138652147) has the molecular formula C13H15F3 and a molecular weight of 228.26 g/mol. Its IUPAC name is 1-[(E)-pent-2-en-2-yl]-4-(2,2,2-trifluoroethyl)benzene.
| Compound Name | 1-[(E)-pent-2-en-2-yl]-4-(2,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 138652147 |
| Molecular Formula | C13H15F3 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1-[(E)-pent-2-en-2-yl]-4-(2,2,2-trifluoroethyl)benzene |
| SMILES | CC/C=C(\C)c1ccc(CC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3/c1-3-4-10(2)12-7-5-11(6-8-12)9-13(14,15)16/h4-8H,3,9H2,1-2H3/b10-4+ |
| InChIKey | NSAIZVXWXBOMQT-ONNFQVAWSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |