C18H24F3NO — CID 176921686
N-[(2Z,4Z)-1-methoxy-4-methylhepta-2,4-dien-2-yl]-N-methyl-4-(2,2,2-trifluoroethyl)aniline (PubChem CID 176921686) has the molecular formula C18H24F3NO and a molecular weight of 327.39 g/mol. Its IUPAC name is N-[(2Z,4Z)-1-methoxy-4-methylhepta-2,4-dien-2-yl]-N-methyl-4-(2,2,2-trifluoroethyl)aniline.
| Compound Name | N-[(2Z,4Z)-1-methoxy-4-methylhepta-2,4-dien-2-yl]-N-methyl-4-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 176921686 |
| Molecular Formula | C18H24F3NO |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | N-[(2Z,4Z)-1-methoxy-4-methylhepta-2,4-dien-2-yl]-N-methyl-4-(2,2,2-trifluoroethyl)aniline |
| SMILES | CC/C=C(C)\C=C(\COC)N(C)c1ccc(CC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H24F3NO/c1-5-6-14(2)11-17(13-23-4)22(3)16-9-7-15(8-10-16)12-18(19,20)21/h6-11H,5,12-13H2,1-4H3/b14-6-,17-11- |
| InChIKey | GAJDGQPECHDYSJ-TUMBAZEKSA-N |
| XLogP | 5.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|