C16H20F3NO — CID 145347468
N-[(2Z)-4,5-dimethylhexa-2,4-dien-2-yl]-N-methyl-4-(trifluoromethoxy)aniline (PubChem CID 145347468) has the molecular formula C16H20F3NO and a molecular weight of 299.34 g/mol. Its IUPAC name is N-[(2Z)-4,5-dimethylhexa-2,4-dien-2-yl]-N-methyl-4-(trifluoromethoxy)aniline.
| Compound Name | N-[(2Z)-4,5-dimethylhexa-2,4-dien-2-yl]-N-methyl-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 145347468 |
| Molecular Formula | C16H20F3NO |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-[(2Z)-4,5-dimethylhexa-2,4-dien-2-yl]-N-methyl-4-(trifluoromethoxy)aniline |
| SMILES | CC(C)=C(C)/C=C(/C)N(C)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H20F3NO/c1-11(2)12(3)10-13(4)20(5)14-6-8-15(9-7-14)21-16(17,18)19/h6-10H,1-5H3/b13-10- |
| InChIKey | CTZNQJJHMONDEJ-RAXLEYEMSA-N |
| XLogP | 5.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|