C16H23F3N2O — CID 176922237
(3Z)-4-N-methyl-4-N-[4-(trifluoromethoxy)phenyl]penta-1,3-diene-2,4-diamine;propane (PubChem CID 176922237) has the molecular formula C16H23F3N2O and a molecular weight of 316.37 g/mol. Its IUPAC name is (3Z)-4-N-methyl-4-N-[4-(trifluoromethoxy)phenyl]penta-1,3-diene-2,4-diamine;propane.
| Compound Name | (3Z)-4-N-methyl-4-N-[4-(trifluoromethoxy)phenyl]penta-1,3-diene-2,4-diamine;propane |
|---|---|
| PubChem CID | 176922237 |
| Molecular Formula | C16H23F3N2O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (3Z)-4-N-methyl-4-N-[4-(trifluoromethoxy)phenyl]penta-1,3-diene-2,4-diamine;propane |
| SMILES | C=C(N)/C=C(/C)N(C)c1ccc(OC(F)(F)F)cc1.CCC |
| InChI | InChI=1S/C13H15F3N2O.C3H8/c1-9(17)8-10(2)18(3)11-4-6-12(7-5-11)19-13(14,15)16;1-3-2/h4-8H,1,17H2,2-3H3;3H2,1-2H3/b10-8-; |
| InChIKey | IFYRTRSRGSTNJU-DQMXGCRQSA-N |
| XLogP | 4.81 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|