C13H15F3O — CID 70222036
1-(2,3-dimethylbut-3-en-2-yl)-4-(trifluoromethoxy)benzene (PubChem CID 70222036) has the molecular formula C13H15F3O and a molecular weight of 244.26 g/mol. Its IUPAC name is 1-(2,3-dimethylbut-3-en-2-yl)-4-(trifluoromethoxy)benzene.
| Compound Name | 1-(2,3-dimethylbut-3-en-2-yl)-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 70222036 |
| Molecular Formula | C13H15F3O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1-(2,3-dimethylbut-3-en-2-yl)-4-(trifluoromethoxy)benzene |
| SMILES | C=C(C)C(C)(C)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3O/c1-9(2)12(3,4)10-5-7-11(8-6-10)17-13(14,15)16/h5-8H,1H2,2-4H3 |
| InChIKey | HPDJPHBBEAJMQM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|