C18H25BrF3NO — CID 176921158
N-[(2Z,4Z)-4-bromo-5-methylhepta-2,4-dien-2-yl]-N-methyl-4-(trifluoromethoxy)aniline;ethane (PubChem CID 176921158) has the molecular formula C18H25BrF3NO and a molecular weight of 408.30 g/mol. Its IUPAC name is N-[(2Z,4Z)-4-bromo-5-methylhepta-2,4-dien-2-yl]-N-methyl-4-(trifluoromethoxy)aniline;ethane.
| Compound Name | N-[(2Z,4Z)-4-bromo-5-methylhepta-2,4-dien-2-yl]-N-methyl-4-(trifluoromethoxy)aniline;ethane |
|---|---|
| PubChem CID | 176921158 |
| Molecular Formula | C18H25BrF3NO |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[(2Z,4Z)-4-bromo-5-methylhepta-2,4-dien-2-yl]-N-methyl-4-(trifluoromethoxy)aniline;ethane |
| SMILES | CC.CC/C(C)=C(Br)/C=C(/C)N(C)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19BrF3NO.C2H6/c1-5-11(2)15(17)10-12(3)21(4)13-6-8-14(9-7-13)22-16(18,19)20;1-2/h6-10H,5H2,1-4H3;1-2H3/b12-10-,15-11-; |
| InChIKey | SRTHGTNDTJLZOS-MCPLCZMQSA-N |
| XLogP | 7.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|