C17H22BrF2NO — CID 176922160
N-[(2Z,4Z)-4-bromo-5-methylhepta-2,4-dien-2-yl]-4-(1,1-difluoroethoxy)-N-methylaniline (PubChem CID 176922160) has the molecular formula C17H22BrF2NO and a molecular weight of 374.27 g/mol. Its IUPAC name is N-[(2Z,4Z)-4-bromo-5-methylhepta-2,4-dien-2-yl]-4-(1,1-difluoroethoxy)-N-methylaniline.
| Compound Name | N-[(2Z,4Z)-4-bromo-5-methylhepta-2,4-dien-2-yl]-4-(1,1-difluoroethoxy)-N-methylaniline |
|---|---|
| PubChem CID | 176922160 |
| Molecular Formula | C17H22BrF2NO |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-[(2Z,4Z)-4-bromo-5-methylhepta-2,4-dien-2-yl]-4-(1,1-difluoroethoxy)-N-methylaniline |
| SMILES | CC/C(C)=C(Br)/C=C(/C)N(C)c1ccc(OC(C)(F)F)cc1 |
| InChI | InChI=1S/C17H22BrF2NO/c1-6-12(2)16(18)11-13(3)21(5)14-7-9-15(10-8-14)22-17(4,19)20/h7-11H,6H2,1-5H3/b13-11-,16-12- |
| InChIKey | QAGYBIYSUUCCNL-KZWIATNNSA-N |
| XLogP | 6.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|