C16H14Br2F2O2S — CID 162098488
1-bromo-4-(1,1-difluoroethoxy)benzene;O-(4-bromophenyl) ethanethioate (PubChem CID 162098488) has the molecular formula C16H14Br2F2O2S and a molecular weight of 468.16 g/mol. Its IUPAC name is 1-bromo-4-(1,1-difluoroethoxy)benzene;O-(4-bromophenyl) ethanethioate.
| Compound Name | 1-bromo-4-(1,1-difluoroethoxy)benzene;O-(4-bromophenyl) ethanethioate |
|---|---|
| PubChem CID | 162098488 |
| Molecular Formula | C16H14Br2F2O2S |
| Molecular Weight | 468.16 g/mol |
| Exact Mass | 465.90 |
| IUPAC Name | 1-bromo-4-(1,1-difluoroethoxy)benzene;O-(4-bromophenyl) ethanethioate |
| SMILES | CC(=S)Oc1ccc(Br)cc1.CC(F)(F)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C8H7BrF2O.C8H7BrOS/c1-8(10,11)12-7-4-2-6(9)3-5-7;1-6(11)10-8-4-2-7(9)3-5-8/h2-5H,1H3;2-5H,1H3 |
| InChIKey | ZEOIZDWKSKJEEW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.16 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|