C10H9ClF2O3 — CID 142905158
2-[4-(1,1-difluoroethoxy)phenoxy]acetyl chloride (PubChem CID 142905158) has the molecular formula C10H9ClF2O3 and a molecular weight of 250.63 g/mol. Its IUPAC name is 2-[4-(1,1-difluoroethoxy)phenoxy]acetyl chloride.
| Compound Name | 2-[4-(1,1-difluoroethoxy)phenoxy]acetyl chloride |
|---|---|
| PubChem CID | 142905158 |
| Molecular Formula | C10H9ClF2O3 |
| Molecular Weight | 250.63 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2-[4-(1,1-difluoroethoxy)phenoxy]acetyl chloride |
| SMILES | CC(F)(F)Oc1ccc(OCC(=O)Cl)cc1 |
| InChI | InChI=1S/C10H9ClF2O3/c1-10(12,13)16-8-4-2-7(3-5-8)15-6-9(11)14/h2-5H,6H2,1H3 |
| InChIKey | OBWKGVXAOMEVPP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.63 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|