C15H17F3O5 — CID 162580031
methyl (E)-5-hydroxy-5-methoxy-2-[4-(2,2,2-trifluoroethyl)phenoxy]pent-2-enoate (PubChem CID 162580031) has the molecular formula C15H17F3O5 and a molecular weight of 334.29 g/mol. Its IUPAC name is methyl (E)-5-hydroxy-5-methoxy-2-[4-(2,2,2-trifluoroethyl)phenoxy]pent-2-enoate.
| Compound Name | methyl (E)-5-hydroxy-5-methoxy-2-[4-(2,2,2-trifluoroethyl)phenoxy]pent-2-enoate |
|---|---|
| PubChem CID | 162580031 |
| Molecular Formula | C15H17F3O5 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | methyl (E)-5-hydroxy-5-methoxy-2-[4-(2,2,2-trifluoroethyl)phenoxy]pent-2-enoate |
| SMILES | COC(=O)/C(=C\CC(O)OC)Oc1ccc(CC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H17F3O5/c1-21-13(19)8-7-12(14(20)22-2)23-11-5-3-10(4-6-11)9-15(16,17)18/h3-7,13,19H,8-9H2,1-2H3/b12-7+ |
| InChIKey | QFYJAKHMAUZBRR-KPKJPENVSA-N |
| XLogP | 2.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|