C13H21N — CID 143104199
2-[(Z)-but-1-enyl]-N-methylhexa-2,3,5-trien-1-imine;ethane (PubChem CID 143104199) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 2-[(Z)-but-1-enyl]-N-methylhexa-2,3,5-trien-1-imine;ethane.
| Compound Name | 2-[(Z)-but-1-enyl]-N-methylhexa-2,3,5-trien-1-imine;ethane |
|---|---|
| PubChem CID | 143104199 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 2-[(Z)-but-1-enyl]-N-methylhexa-2,3,5-trien-1-imine;ethane |
| SMILES | C=CC=C=C(/C=C\CC)/C=N/C.CC |
| InChI | InChI=1S/C11H15N.C2H6/c1-4-6-8-11(10-12-3)9-7-5-2;1-2/h4,6-7,9-10H,1,5H2,2-3H3;1-2H3/b9-7-,12-10+; |
| InChIKey | UZYGZFZMMYYHQJ-MSMPZYMUSA-N |
| XLogP | 3.95 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|