C12H25NO — CID 145078658
(E)-5,5-dimethyl-1-(methylamino)hept-2-en-4-one;ethane (PubChem CID 145078658) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is (E)-5,5-dimethyl-1-(methylamino)hept-2-en-4-one;ethane.
| Compound Name | (E)-5,5-dimethyl-1-(methylamino)hept-2-en-4-one;ethane |
|---|---|
| PubChem CID | 145078658 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | (E)-5,5-dimethyl-1-(methylamino)hept-2-en-4-one;ethane |
| SMILES | CC.CCC(C)(C)C(=O)/C=C/CNC |
| InChI | InChI=1S/C10H19NO.C2H6/c1-5-10(2,3)9(12)7-6-8-11-4;1-2/h6-7,11H,5,8H2,1-4H3;1-2H3/b7-6+; |
| InChIKey | GFUIRYJXLUYTMB-UHDJGPCESA-N |
| XLogP | 2.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|