C16H26O — CID 89128735
(5E,7E,9E)-3,3,12-trimethyltrideca-5,7,9-trien-4-one (PubChem CID 89128735) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (5E,7E,9E)-3,3,12-trimethyltrideca-5,7,9-trien-4-one.
| Compound Name | (5E,7E,9E)-3,3,12-trimethyltrideca-5,7,9-trien-4-one |
|---|---|
| PubChem CID | 89128735 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (5E,7E,9E)-3,3,12-trimethyltrideca-5,7,9-trien-4-one |
| SMILES | CCC(C)(C)C(=O)/C=C/C=C/C=C/CC(C)C |
| InChI | InChI=1S/C16H26O/c1-6-16(4,5)15(17)13-11-9-7-8-10-12-14(2)3/h7-11,13-14H,6,12H2,1-5H3/b9-7+,10-8+,13-11+ |
| InChIKey | YQTGEHRBEYOANO-CWCVLZLJSA-N |
| XLogP | 4.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|