C18H26O3 — CID 11185384
[(2Z,4E)-7-methylocta-2,4-dienoyl] (2Z,4E)-7-methylocta-2,4-dienoate (PubChem CID 11185384) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is [(2Z,4E)-7-methylocta-2,4-dienoyl] (2Z,4E)-7-methylocta-2,4-dienoate.
| Compound Name | [(2Z,4E)-7-methylocta-2,4-dienoyl] (2Z,4E)-7-methylocta-2,4-dienoate |
|---|---|
| PubChem CID | 11185384 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | [(2Z,4E)-7-methylocta-2,4-dienoyl] (2Z,4E)-7-methylocta-2,4-dienoate |
| SMILES | CC(C)C/C=C/C=C\C(=O)OC(=O)/C=C\C=C\CC(C)C |
| InChI | InChI=1S/C18H26O3/c1-15(2)11-7-5-9-13-17(19)21-18(20)14-10-6-8-12-16(3)4/h5-10,13-16H,11-12H2,1-4H3/b7-5+,8-6+,13-9-,14-10- |
| InChIKey | VYHNXQFJXVXURU-FVJCAJFMSA-N |
| XLogP | 4.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|