C15H24O — CID 58017756
(4E,6E,8E)-2,2,11-trimethyldodeca-4,6,8-trien-3-one (PubChem CID 58017756) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (4E,6E,8E)-2,2,11-trimethyldodeca-4,6,8-trien-3-one.
| Compound Name | (4E,6E,8E)-2,2,11-trimethyldodeca-4,6,8-trien-3-one |
|---|---|
| PubChem CID | 58017756 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (4E,6E,8E)-2,2,11-trimethyldodeca-4,6,8-trien-3-one |
| SMILES | CC(C)C/C=C/C=C/C=C/C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H24O/c1-13(2)11-9-7-6-8-10-12-14(16)15(3,4)5/h6-10,12-13H,11H2,1-5H3/b8-6+,9-7+,12-10+ |
| InChIKey | WSPMRFZDKMVYOW-CAPISXRISA-N |
| XLogP | 4.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|