C16H22O3 — CID 51357065
[(2E,4E)-octa-2,4-dienoyl] (2E,4E)-octa-2,4-dienoate (PubChem CID 51357065) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is [(2E,4E)-octa-2,4-dienoyl] (2E,4E)-octa-2,4-dienoate.
| Compound Name | [(2E,4E)-octa-2,4-dienoyl] (2E,4E)-octa-2,4-dienoate |
|---|---|
| PubChem CID | 51357065 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | [(2E,4E)-octa-2,4-dienoyl] (2E,4E)-octa-2,4-dienoate |
| SMILES | CCC/C=C/C=C/C(=O)OC(=O)/C=C/C=C/CCC |
| InChI | InChI=1S/C16H22O3/c1-3-5-7-9-11-13-15(17)19-16(18)14-12-10-8-6-4-2/h7-14H,3-6H2,1-2H3/b9-7+,10-8+,13-11+,14-12+ |
| InChIKey | GNSURYCZXJGZBM-NOEJSRFCSA-N |
| XLogP | 3.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|