About 3-cyanoprop-2-enylurea
3-cyanoprop-2-enylurea (PubChem CID 173463300) has the molecular formula C5H7N3O
and a molecular weight of 125.13 g/mol. Its IUPAC name is 3-cyanoprop-2-enylurea.
Molecular Properties
| Compound Name | 3-cyanoprop-2-enylurea |
| PubChem CID | 173463300 |
| Molecular Formula | C5H7N3O |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.06 |
| IUPAC Name | 3-cyanoprop-2-enylurea |
| SMILES | N#CC=CCNC(N)=O |
| InChI | InChI=1S/C5H7N3O/c6-3-1-2-4-8-5(7)9/h1-2H,4H2,(H3,7,8,9) |
| InChIKey | JHYCYHDUZNQZRM-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 3-cyanoprop-2-enylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyanoprop-2-enylurea?
The IUPAC name of 3-cyanoprop-2-enylurea (CID 173463300) is 3-cyanoprop-2-enylurea.
What is the SMILES notation for 3-cyanoprop-2-enylurea?
The canonical SMILES for 3-cyanoprop-2-enylurea is N#CC=CCNC(N)=O.
What is the InChIKey of 3-cyanoprop-2-enylurea?
The InChIKey is JHYCYHDUZNQZRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O/c6-3-1-2-4-8-5(7)9/h1-2H,4H2,(H3,7,8,9).
What are the key properties of 3-cyanoprop-2-enylurea?
3-cyanoprop-2-enylurea has a molecular weight of 125.13 g/mol, XLogP of -0.27, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyanoprop-2-enylurea is sourced from PubChem (CID 173463300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).