C7H13N — CID 130242711
(3E)-2-methylhexa-1,3-dien-3-amine (PubChem CID 130242711) has the molecular formula C7H13N and a molecular weight of 111.19 g/mol. Its IUPAC name is (3E)-2-methylhexa-1,3-dien-3-amine.
| Compound Name | (3E)-2-methylhexa-1,3-dien-3-amine |
|---|---|
| PubChem CID | 130242711 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | (3E)-2-methylhexa-1,3-dien-3-amine |
| SMILES | C=C(C)/C(N)=C\CC |
| InChI | InChI=1S/C7H13N/c1-4-5-7(8)6(2)3/h5H,2,4,8H2,1,3H3/b7-5+ |
| InChIKey | WCPRWPMHIXVXDC-FNORWQNLSA-N |
| XLogP | 1.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|