C10H19N — CID 156745371
(3E,5Z)-N,2,5-trimethylhepta-3,5-dien-3-amine (PubChem CID 156745371) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (3E,5Z)-N,2,5-trimethylhepta-3,5-dien-3-amine.
| Compound Name | (3E,5Z)-N,2,5-trimethylhepta-3,5-dien-3-amine |
|---|---|
| PubChem CID | 156745371 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (3E,5Z)-N,2,5-trimethylhepta-3,5-dien-3-amine |
| SMILES | C/C=C(C)\C=C(\NC)C(C)C |
| InChI | InChI=1S/C10H19N/c1-6-9(4)7-10(11-5)8(2)3/h6-8,11H,1-5H3/b9-6-,10-7+ |
| InChIKey | ATRUFHVQHYZYNR-PCCLLEMOSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|