C10H19ClO — CID 142330760
(3Z)-3-chloro-4-methoxy-2-methylhexa-1,3-diene;ethane (PubChem CID 142330760) has the molecular formula C10H19ClO and a molecular weight of 190.71 g/mol. Its IUPAC name is (3Z)-3-chloro-4-methoxy-2-methylhexa-1,3-diene;ethane.
| Compound Name | (3Z)-3-chloro-4-methoxy-2-methylhexa-1,3-diene;ethane |
|---|---|
| PubChem CID | 142330760 |
| Molecular Formula | C10H19ClO |
| Molecular Weight | 190.71 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (3Z)-3-chloro-4-methoxy-2-methylhexa-1,3-diene;ethane |
| SMILES | C=C(C)/C(Cl)=C(\CC)OC.CC |
| InChI | InChI=1S/C8H13ClO.C2H6/c1-5-7(10-4)8(9)6(2)3;1-2/h2,5H2,1,3-4H3;1-2H3/b8-7-; |
| InChIKey | JWUAPMDIPDPXLQ-CFYXSCKTSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.71 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|