C8H15NO — CID 137484755
(3E)-4-methoxy-3-methylhexa-1,3-dien-2-amine (PubChem CID 137484755) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (3E)-4-methoxy-3-methylhexa-1,3-dien-2-amine.
| Compound Name | (3E)-4-methoxy-3-methylhexa-1,3-dien-2-amine |
|---|---|
| PubChem CID | 137484755 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (3E)-4-methoxy-3-methylhexa-1,3-dien-2-amine |
| SMILES | C=C(N)/C(C)=C(\CC)OC |
| InChI | InChI=1S/C8H15NO/c1-5-8(10-4)6(2)7(3)9/h3,5,9H2,1-2,4H3/b8-6+ |
| InChIKey | TYKIMKBIHPPNOP-SOFGYWHQSA-N |
| XLogP | 1.79 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|