About acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene
acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene (PubChem CID 165093716) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene.
Molecular Properties
| Compound Name | acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene |
| PubChem CID | 165093716 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C(C)OC.CC(N)=O |
| InChI | InChI=1S/C4H8O.C4H8.C2H5NO/c1-4(2)5-3;1-4(2)3;1-2(3)4/h1H2,2-3H3;1H2,2-3H3;1H3,(H2,3,4) |
| InChIKey | XDLITNIKURAQOU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene?
The IUPAC name of acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene (CID 165093716) is acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene.
What is the SMILES notation for acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene?
The canonical SMILES for acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene is C=C(C)C.C=C(C)OC.CC(N)=O.
What is the InChIKey of acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene?
The InChIKey is XDLITNIKURAQOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C4H8.C2H5NO/c1-4(2)5-3;1-4(2)3;1-2(3)4/h1H2,2-3H3;1H2,2-3H3;1H3,(H2,3,4).
What are the key properties of acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene?
acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene has a molecular weight of 187.28 g/mol, XLogP of 2.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;2-methoxyprop-1-ene;2-methylprop-1-ene is sourced from PubChem (CID 165093716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).