About 2-ethoxybut-1-ene;2-methoxybut-1-ene
2-ethoxybut-1-ene;2-methoxybut-1-ene (PubChem CID 139345076) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 2-ethoxybut-1-ene;2-methoxybut-1-ene.
Molecular Properties
| Compound Name | 2-ethoxybut-1-ene;2-methoxybut-1-ene |
| PubChem CID | 139345076 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2-ethoxybut-1-ene;2-methoxybut-1-ene |
| SMILES | C=C(CC)OC.C=C(CC)OCC |
| InChI | InChI=1S/C6H12O.C5H10O/c1-4-6(3)7-5-2;1-4-5(2)6-3/h3-5H2,1-2H3;2,4H2,1,3H3 |
| InChIKey | BMWWLFMAYJDWNS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxybut-1-ene;2-methoxybut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxybut-1-ene;2-methoxybut-1-ene?
The IUPAC name of 2-ethoxybut-1-ene;2-methoxybut-1-ene (CID 139345076) is 2-ethoxybut-1-ene;2-methoxybut-1-ene.
What is the SMILES notation for 2-ethoxybut-1-ene;2-methoxybut-1-ene?
The canonical SMILES for 2-ethoxybut-1-ene;2-methoxybut-1-ene is C=C(CC)OC.C=C(CC)OCC.
What is the InChIKey of 2-ethoxybut-1-ene;2-methoxybut-1-ene?
The InChIKey is BMWWLFMAYJDWNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C5H10O/c1-4-6(3)7-5-2;1-4-5(2)6-3/h3-5H2,1-2H3;2,4H2,1,3H3.
What are the key properties of 2-ethoxybut-1-ene;2-methoxybut-1-ene?
2-ethoxybut-1-ene;2-methoxybut-1-ene has a molecular weight of 186.29 g/mol, XLogP of 3.50, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxybut-1-ene;2-methoxybut-1-ene is sourced from PubChem (CID 139345076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).