About 1-but-1-en-2-yloxyhexane
1-but-1-en-2-yloxyhexane (PubChem CID 57257919) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is 1-but-1-en-2-yloxyhexane.
Molecular Properties
| Compound Name | 1-but-1-en-2-yloxyhexane |
| PubChem CID | 57257919 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 1-but-1-en-2-yloxyhexane |
| SMILES | C=C(CC)OCCCCCC |
| InChI | InChI=1S/C10H20O/c1-4-6-7-8-9-11-10(3)5-2/h3-9H2,1-2H3 |
| InChIKey | KRJQHENCFRAAHA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-but-1-en-2-yloxyhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-1-en-2-yloxyhexane?
The IUPAC name of 1-but-1-en-2-yloxyhexane (CID 57257919) is 1-but-1-en-2-yloxyhexane.
What is the SMILES notation for 1-but-1-en-2-yloxyhexane?
The canonical SMILES for 1-but-1-en-2-yloxyhexane is C=C(CC)OCCCCCC.
What is the InChIKey of 1-but-1-en-2-yloxyhexane?
The InChIKey is KRJQHENCFRAAHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O/c1-4-6-7-8-9-11-10(3)5-2/h3-9H2,1-2H3.
What are the key properties of 1-but-1-en-2-yloxyhexane?
1-but-1-en-2-yloxyhexane has a molecular weight of 156.27 g/mol, XLogP of 3.51, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-1-en-2-yloxyhexane is sourced from PubChem (CID 57257919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).