C10H20O4 — CID 18913851
2-[2-(2-but-1-en-2-yloxyethoxy)ethoxy]ethanol (PubChem CID 18913851) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-[2-(2-but-1-en-2-yloxyethoxy)ethoxy]ethanol.
| Compound Name | 2-[2-(2-but-1-en-2-yloxyethoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 18913851 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-[2-(2-but-1-en-2-yloxyethoxy)ethoxy]ethanol |
| SMILES | C=C(CC)OCCOCCOCCO |
| InChI | InChI=1S/C10H20O4/c1-3-10(2)14-9-8-13-7-6-12-5-4-11/h11H,2-9H2,1H3 |
| InChIKey | BPOUBOVRXPALEK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|